C26H30O8 — CID 163171535
2-[(1R,2S,5R,6R,11S,16S)-6-(furan-3-yl)-11,14-dihydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,13-dien-16-yl]acetic acid (PubChem CID 163171535) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[(1R,2S,5R,6R,11S,16S)-6-(furan-3-yl)-11,14-dihydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,13-dien-16-yl]acetic acid.
| Compound Name | 2-[(1R,2S,5R,6R,11S,16S)-6-(furan-3-yl)-11,14-dihydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,13-dien-16-yl]acetic acid |
|---|---|
| PubChem CID | 163171535 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[(1R,2S,5R,6R,11S,16S)-6-(furan-3-yl)-11,14-dihydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-9,13-dien-16-yl]acetic acid |
| SMILES | CC1(C)C(O)=C2C[C@@]3(O)C4=CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@H]3[C@](C)(C2=O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C26H30O8/c1-23(2)16(9-18(27)28)25(4)15-5-7-24(3)17(26(15,32)11-14(20(23)30)21(25)31)10-19(29)34-22(24)13-6-8-33-12-13/h6,8,10,12,15-16,22,30,32H,5,7,9,11H2,1-4H3,(H,27,28)/t15-,16-,22-,24+,25-,26-/m0/s1 |
| InChIKey | VOMMEJOYAVKCOU-IAORTERFSA-N |
| XLogP | 3.87 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |