C20H18N2O8 — CID 163173883
[(1S,2R,3S,4R)-2-acetyloxy-1,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide (PubChem CID 163173883) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-2-acetyloxy-1,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide.
| Compound Name | [(1S,2R,3S,4R)-2-acetyloxy-1,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide |
|---|---|
| PubChem CID | 163173883 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(1S,2R,3S,4R)-2-acetyloxy-1,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide |
| SMILES | CC(=O)O[C@]1(C)[C@@H](O)C2=C(C3=C(C(=O)c4c(O)cccc4C3=O)C2[NH+]=[N-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H18N2O8/c1-6(23)30-20(2)18(28)13-11(17(27)19(20)29)10-12(14(13)22-21)16(26)9-7(15(10)25)4-3-5-8(9)24/h3-5,14,17-19,22,24,27-29H,1-2H3/t14?,17-,18+,19+,20-/m1/s1 |
| InChIKey | WLUKOMCQEZVTKQ-PSTOSHBPSA-N |
| XLogP | -1.73 |
| TPSA | 177.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|