C22H20N2O9 — CID 163156020
[(1R,2S,3S,4R)-1,3-diacetyloxy-2,4,9-trihydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide (PubChem CID 163156020) has the molecular formula C22H20N2O9 and a molecular weight of 456.41 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-1,3-diacetyloxy-2,4,9-trihydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide.
| Compound Name | [(1R,2S,3S,4R)-1,3-diacetyloxy-2,4,9-trihydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide |
|---|---|
| PubChem CID | 163156020 |
| Molecular Formula | C22H20N2O9 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [(1R,2S,3S,4R)-1,3-diacetyloxy-2,4,9-trihydroxy-2-methyl-5,10-dioxo-1,3,4,11-tetrahydrobenzo[b]fluoren-11-yl]azaniumylideneazanide |
| SMILES | CC(=O)O[C@@H]1C2=C(C3=C(C(=O)c4c(O)cccc4C3=O)C2[NH+]=[N-])[C@@H](O)[C@H](OC(C)=O)[C@@]1(C)O |
| InChI | InChI=1S/C22H20N2O9/c1-7(25)32-20-15-13(19(30)21(22(20,3)31)33-8(2)26)12-14(16(15)24-23)18(29)11-9(17(12)28)5-4-6-10(11)27/h4-6,16,19-21,24,27,30-31H,1-3H3/t16?,19-,20-,21+,22+/m1/s1 |
| InChIKey | PDCBOVYWURQLNP-OHWXQCLISA-N |
| XLogP | -1.16 |
| TPSA | 183.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|