C22H22N2O9 — CID 163127700
[(1R,2R,3R,4S)-1-acetyloxy-11-hydrazinylidene-2,4,5,9,10-pentahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-3-yl] acetate (PubChem CID 163127700) has the molecular formula C22H22N2O9 and a molecular weight of 458.42 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-1-acetyloxy-11-hydrazinylidene-2,4,5,9,10-pentahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-3-yl] acetate.
| Compound Name | [(1R,2R,3R,4S)-1-acetyloxy-11-hydrazinylidene-2,4,5,9,10-pentahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-3-yl] acetate |
|---|---|
| PubChem CID | 163127700 |
| Molecular Formula | C22H22N2O9 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [(1R,2R,3R,4S)-1-acetyloxy-11-hydrazinylidene-2,4,5,9,10-pentahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2=C(c3c(c(O)c4c(O)cccc4c3O)C2=NN)[C@H](O)[C@@H](OC(C)=O)[C@]1(C)O |
| InChI | InChI=1S/C22H22N2O9/c1-7(25)32-20-15-13(19(30)21(22(20,3)31)33-8(2)26)12-14(16(15)24-23)18(29)11-9(17(12)28)5-4-6-10(11)27/h4-6,19-21,27-31H,23H2,1-3H3/t19-,20+,21+,22+/m0/s1 |
| InChIKey | URPIWHSZSMKNIF-DXBBTUNJSA-N |
| XLogP | 0.38 |
| TPSA | 192.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|