C20H18N2O8 — CID 23657841
[(1R,2R,3R,4S)-11-diazo-2,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-3,4,4b,10a-tetrahydro-1H-benzo[h]fluoren-1-yl] acetate (PubChem CID 23657841) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-11-diazo-2,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-3,4,4b,10a-tetrahydro-1H-benzo[h]fluoren-1-yl] acetate.
| Compound Name | [(1R,2R,3R,4S)-11-diazo-2,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-3,4,4b,10a-tetrahydro-1H-benzo[h]fluoren-1-yl] acetate |
|---|---|
| PubChem CID | 23657841 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(1R,2R,3R,4S)-11-diazo-2,3,4,9-tetrahydroxy-2-methyl-5,10-dioxo-3,4,4b,10a-tetrahydro-1H-benzo[h]fluoren-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2=C(C3C(=O)c4cccc(O)c4C(=O)C3C2=[N+]=[N-])[C@H](O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C20H18N2O8/c1-6(23)30-19-13-11(17(27)18(28)20(19,2)29)10-12(14(13)22-21)16(26)9-7(15(10)25)4-3-5-8(9)24/h3-5,10,12,17-19,24,27-29H,1-2H3/t10?,12?,17-,18+,19+,20+/m0/s1 |
| InChIKey | MALXVFRAOACKGO-BGMLUJJHSA-N |
| XLogP | -0.60 |
| TPSA | 177.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|