C12H10O2 — CID 163187892
2-[(1S)-1-hydroxyhexa-2,4-diynyl]phenol (PubChem CID 163187892) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-[(1S)-1-hydroxyhexa-2,4-diynyl]phenol.
| Compound Name | 2-[(1S)-1-hydroxyhexa-2,4-diynyl]phenol |
|---|---|
| PubChem CID | 163187892 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 2-[(1S)-1-hydroxyhexa-2,4-diynyl]phenol |
| SMILES | CC#CC#C[C@H](O)c1ccccc1O |
| InChI | InChI=1S/C12H10O2/c1-2-3-4-8-11(13)10-7-5-6-9-12(10)14/h5-7,9,11,13-14H,1H3/t11-/m0/s1 |
| InChIKey | ATIXAFFLDCRLCX-NSHDSACASA-N |
| XLogP | 1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|