C20H30N2O6 — CID 163192770
4-acetyl-2-butan-2-yl-3-hydroxy-1,2-dihydropyrrol-5-one (PubChem CID 163192770) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-acetyl-2-butan-2-yl-3-hydroxy-1,2-dihydropyrrol-5-one.
| Compound Name | 4-acetyl-2-butan-2-yl-3-hydroxy-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 163192770 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 4-acetyl-2-butan-2-yl-3-hydroxy-1,2-dihydropyrrol-5-one |
| SMILES | CCC(C)C1NC(=O)C(C(C)=O)=C1O.CCC(C)C1NC(=O)C(C(C)=O)=C1O |
| InChI | InChI=1S/2C10H15NO3/c2*1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h2*5,8,13H,4H2,1-3H3,(H,11,14) |
| InChIKey | OEDJIVITDBUFBR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|