C22H26O8 — CID 163193998
(3R,3aS,6R,6aS)-3,6-bis(2,3-dimethoxyphenoxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (PubChem CID 163193998) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is (3R,3aS,6R,6aS)-3,6-bis(2,3-dimethoxyphenoxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan.
| Compound Name | (3R,3aS,6R,6aS)-3,6-bis(2,3-dimethoxyphenoxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
|---|---|
| PubChem CID | 163193998 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (3R,3aS,6R,6aS)-3,6-bis(2,3-dimethoxyphenoxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
| SMILES | COc1cccc(O[C@H]2OC[C@H]3[C@@H](Oc4cccc(OC)c4OC)OC[C@@H]23)c1OC |
| InChI | InChI=1S/C22H26O8/c1-23-15-7-5-9-17(19(15)25-3)29-21-13-11-28-22(14(13)12-27-21)30-18-10-6-8-16(24-2)20(18)26-4/h5-10,13-14,21-22H,11-12H2,1-4H3/t13-,14-,21-,22-/m1/s1 |
| InChIKey | NEWIMESFSVSIEO-LPINMEDASA-N |
| XLogP | 3.12 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |