C13H22F2N2O3S — CID 163212468
tert-butyl N-[(4,4-difluoro-3-methylcyclohexyl)sulfanylcarbamoyl]carbamate (PubChem CID 163212468) has the molecular formula C13H22F2N2O3S and a molecular weight of 324.39 g/mol. Its IUPAC name is tert-butyl N-[(4,4-difluoro-3-methylcyclohexyl)sulfanylcarbamoyl]carbamate.
| Compound Name | tert-butyl N-[(4,4-difluoro-3-methylcyclohexyl)sulfanylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 163212468 |
| Molecular Formula | C13H22F2N2O3S |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | tert-butyl N-[(4,4-difluoro-3-methylcyclohexyl)sulfanylcarbamoyl]carbamate |
| SMILES | CC1CC(SNC(=O)NC(=O)OC(C)(C)C)CCC1(F)F |
| InChI | InChI=1S/C13H22F2N2O3S/c1-8-7-9(5-6-13(8,14)15)21-17-10(18)16-11(19)20-12(2,3)4/h8-9H,5-7H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | OLOGXUIJCOZYRB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|