C9H19N3O4 — CID 163216246
3-amino-N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]propanamide (PubChem CID 163216246) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-amino-N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]propanamide.
| Compound Name | 3-amino-N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 163216246 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-amino-N-[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl]propanamide |
| SMILES | NCCC(=O)NCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H19N3O4/c10-2-1-8(15)11-7-9(16)12(3-5-13)4-6-14/h13-14H,1-7,10H2,(H,11,15) |
| InChIKey | RMHJRHGOCOVUDM-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |