C22H21N — CID 163217179
2-[(E)-1,2-bis(4-methylphenyl)ethenyl]-6-methylpyridine (PubChem CID 163217179) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[(E)-1,2-bis(4-methylphenyl)ethenyl]-6-methylpyridine.
| Compound Name | 2-[(E)-1,2-bis(4-methylphenyl)ethenyl]-6-methylpyridine |
|---|---|
| PubChem CID | 163217179 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[(E)-1,2-bis(4-methylphenyl)ethenyl]-6-methylpyridine |
| SMILES | Cc1ccc(/C=C(\c2ccc(C)cc2)c2cccc(C)n2)cc1 |
| InChI | InChI=1S/C22H21N/c1-16-7-11-19(12-8-16)15-21(20-13-9-17(2)10-14-20)22-6-4-5-18(3)23-22/h4-15H,1-3H3/b21-15+ |
| InChIKey | MZLUWYBMLIUIDF-RCCKNPSSSA-N |
| XLogP | 5.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|