C29H42N6O — CID 163223267
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine;1-methylpyrrolidine (PubChem CID 163223267) has the molecular formula C29H42N6O and a molecular weight of 490.70 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine;1-methylpyrrolidine.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine;1-methylpyrrolidine |
|---|---|
| PubChem CID | 163223267 |
| Molecular Formula | C29H42N6O |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.34 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine;1-methylpyrrolidine |
| SMILES | CN1CCCC1.COc1nc2c(c(N3CC4CCC(C3)N4)n1)CCN(c1cccc3c1CCCC3)C2 |
| InChI | InChI=1S/C24H31N5O.C5H11N/c1-30-24-26-21-15-28(22-8-4-6-16-5-2-3-7-19(16)22)12-11-20(21)23(27-24)29-13-17-9-10-18(14-29)25-17;1-6-4-2-3-5-6/h4,6,8,17-18,25H,2-3,5,7,9-15H2,1H3;2-5H2,1H3 |
| InChIKey | ZFBPOFHSVWQHEB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |