C12H16F2N2O — CID 163237844
5-(4,4-difluoropiperidin-3-yl)-1-ethylpyridin-2-one (PubChem CID 163237844) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-(4,4-difluoropiperidin-3-yl)-1-ethylpyridin-2-one.
| Compound Name | 5-(4,4-difluoropiperidin-3-yl)-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 163237844 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-(4,4-difluoropiperidin-3-yl)-1-ethylpyridin-2-one |
| SMILES | CCn1cc(C2CNCCC2(F)F)ccc1=O |
| InChI | InChI=1S/C12H16F2N2O/c1-2-16-8-9(3-4-11(16)17)10-7-15-6-5-12(10,13)14/h3-4,8,10,15H,2,5-7H2,1H3 |
| InChIKey | IRZSZLSWCPHMPR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |