C28H44ClN2O6S+ — CID 163239941
10-carboxydecyl(chlorooxy)oxidanium;3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine;ethane (PubChem CID 163239941) has the molecular formula C28H44ClN2O6S+ and a molecular weight of 572.19 g/mol. Its IUPAC name is 10-carboxydecyl(chlorooxy)oxidanium;3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine;ethane.
| Compound Name | 10-carboxydecyl(chlorooxy)oxidanium;3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine;ethane |
|---|---|
| PubChem CID | 163239941 |
| Molecular Formula | C28H44ClN2O6S+ |
| Molecular Weight | 572.19 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 10-carboxydecyl(chlorooxy)oxidanium;3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine;ethane |
| SMILES | CC.Cc1ccc2c(c1)S(=O)(=O)N(C)c1ccccc1C2N.O=C(O)CCCCCCCCCC[OH+]OCl |
| InChI | InChI=1S/C15H16N2O2S.C11H21ClO4.C2H6/c1-10-7-8-12-14(9-10)20(18,19)17(2)13-6-4-3-5-11(13)15(12)16;12-16-15-10-8-6-4-2-1-3-5-7-9-11(13)14;1-2/h3-9,15H,16H2,1-2H3;1-10H2,(H,13,14);1-2H3/p+1 |
| InChIKey | ZOZGWFAFZOZGPM-UHFFFAOYSA-O |
| XLogP | 6.40 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.19 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|