C12H15NO — CID 163242327
(4S)-2,4-dimethyl-4,5-dihydro-1H-2-benzazepin-3-one (PubChem CID 163242327) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (4S)-2,4-dimethyl-4,5-dihydro-1H-2-benzazepin-3-one.
| Compound Name | (4S)-2,4-dimethyl-4,5-dihydro-1H-2-benzazepin-3-one |
|---|---|
| PubChem CID | 163242327 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (4S)-2,4-dimethyl-4,5-dihydro-1H-2-benzazepin-3-one |
| SMILES | C[C@H]1Cc2ccccc2CN(C)C1=O |
| InChI | InChI=1S/C12H15NO/c1-9-7-10-5-3-4-6-11(10)8-13(2)12(9)14/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | PRZKFIAKTRLPHM-VIFPVBQESA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |