C17H26BrN3O2 — CID 163265436
trans-(1R,3R)-3-[[6-bromo-4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-2-pyridinyl]amino]cyclopentan-1-ol (PubChem CID 163265436) has the molecular formula C17H26BrN3O2 and a molecular weight of 384.32 g/mol. Its IUPAC name is trans-(1R,3R)-3-[[6-bromo-4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-2-pyridinyl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,3R)-3-[[6-bromo-4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-2-pyridinyl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 163265436 |
| Molecular Formula | C17H26BrN3O2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | trans-(1R,3R)-3-[[6-bromo-4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-2-pyridinyl]amino]cyclopentan-1-ol |
| SMILES | C[C@@H]1CN(Cc2cc(Br)nc(N[C@@H]3CC[C@@H](O)C3)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H26BrN3O2/c1-11-8-21(9-12(2)23-11)10-13-5-16(18)20-17(6-13)19-14-3-4-15(22)7-14/h5-6,11-12,14-15,22H,3-4,7-10H2,1-2H3,(H,19,20)/t11-,12+,14-,15-/m1/s1 |
| InChIKey | JOYPYCZMQBWAQD-AYRXBEOTSA-N |
| XLogP | 2.78 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|