About 2,5-dimethylhex-2-ene;rubidium(1+)
2,5-dimethylhex-2-ene;rubidium(1+) (PubChem CID 163273002) has the molecular formula C8H15Rb
and a molecular weight of 196.68 g/mol. Its IUPAC name is 2,5-dimethylhex-2-ene;rubidium(1+).
Molecular Properties
| Compound Name | 2,5-dimethylhex-2-ene;rubidium(1+) |
| PubChem CID | 163273002 |
| Molecular Formula | C8H15Rb |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2,5-dimethylhex-2-ene;rubidium(1+) |
| SMILES | CC(C)=[C-]CC(C)C.[Rb+] |
| InChI | InChI=1S/C8H15.Rb/c1-7(2)5-6-8(3)4;/h7H,5H2,1-4H3;/q-1;+1 |
| InChIKey | DWTBZOSBQBKKRE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylhex-2-ene;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylhex-2-ene;rubidium(1+)?
The IUPAC name of 2,5-dimethylhex-2-ene;rubidium(1+) (CID 163273002) is 2,5-dimethylhex-2-ene;rubidium(1+).
What is the SMILES notation for 2,5-dimethylhex-2-ene;rubidium(1+)?
The canonical SMILES for 2,5-dimethylhex-2-ene;rubidium(1+) is CC(C)=[C-]CC(C)C.[Rb+].
What is the InChIKey of 2,5-dimethylhex-2-ene;rubidium(1+)?
The InChIKey is DWTBZOSBQBKKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.Rb/c1-7(2)5-6-8(3)4;/h7H,5H2,1-4H3;/q-1;+1.
What are the key properties of 2,5-dimethylhex-2-ene;rubidium(1+)?
2,5-dimethylhex-2-ene;rubidium(1+) has a molecular weight of 196.68 g/mol, XLogP of -0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylhex-2-ene;rubidium(1+) is sourced from PubChem (CID 163273002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).