C16H22BN3O4 — CID 163275324
2-[1-(6,7-dimethoxyquinazolin-4-yl)-3-methylazetidin-3-yl]ethylboronic acid (PubChem CID 163275324) has the molecular formula C16H22BN3O4 and a molecular weight of 331.18 g/mol. Its IUPAC name is 2-[1-(6,7-dimethoxyquinazolin-4-yl)-3-methylazetidin-3-yl]ethylboronic acid.
| Compound Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)-3-methylazetidin-3-yl]ethylboronic acid |
|---|---|
| PubChem CID | 163275324 |
| Molecular Formula | C16H22BN3O4 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)-3-methylazetidin-3-yl]ethylboronic acid |
| SMILES | COc1cc2ncnc(N3CC(C)(CCB(O)O)C3)c2cc1OC |
| InChI | InChI=1S/C16H22BN3O4/c1-16(4-5-17(21)22)8-20(9-16)15-11-6-13(23-2)14(24-3)7-12(11)18-10-19-15/h6-7,10,21-22H,4-5,8-9H2,1-3H3 |
| InChIKey | KQHBNIVUEFPDJP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|