C23H17F4N3O4 — CID 163299010
2-oxo-N-[2,3,5,6-tetrafluoro-4-[3-(2-hydroxypropoxy)phenyl]phenyl]-1H-pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 163299010) has the molecular formula C23H17F4N3O4 and a molecular weight of 475.40 g/mol. Its IUPAC name is 2-oxo-N-[2,3,5,6-tetrafluoro-4-[3-(2-hydroxypropoxy)phenyl]phenyl]-1H-pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[2,3,5,6-tetrafluoro-4-[3-(2-hydroxypropoxy)phenyl]phenyl]-1H-pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163299010 |
| Molecular Formula | C23H17F4N3O4 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-oxo-N-[2,3,5,6-tetrafluoro-4-[3-(2-hydroxypropoxy)phenyl]phenyl]-1H-pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(O)COc1cccc(-c2c(F)c(F)c(NC(=O)c3c(=O)[nH]n4ccccc34)c(F)c2F)c1 |
| InChI | InChI=1S/C23H17F4N3O4/c1-11(31)10-34-13-6-4-5-12(9-13)15-17(24)19(26)21(20(27)18(15)25)28-22(32)16-14-7-2-3-8-30(14)29-23(16)33/h2-9,11,31H,10H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | IWGHCLOHAWPDKV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|