C31H31F3N2O8 — CID 163320704
6-[[(1E)-1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethyl]amino]-N-[4-(trifluoromethoxy)phenyl]hexanamide (PubChem CID 163320704) has the molecular formula C31H31F3N2O8 and a molecular weight of 616.59 g/mol. Its IUPAC name is 6-[[(1E)-1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethyl]amino]-N-[4-(trifluoromethoxy)phenyl]hexanamide.
| Compound Name | 6-[[(1E)-1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethyl]amino]-N-[4-(trifluoromethoxy)phenyl]hexanamide |
|---|---|
| PubChem CID | 163320704 |
| Molecular Formula | C31H31F3N2O8 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 6-[[(1E)-1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethyl]amino]-N-[4-(trifluoromethoxy)phenyl]hexanamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCCCCC(=O)Nc3ccc(OC(F)(F)F)cc3)C(=O)C12C |
| InChI | InChI=1S/C31H31F3N2O8/c1-15-26(40)24(17(3)37)28-25(27(15)41)30(4)21(43-28)14-20(38)23(29(30)42)16(2)35-13-7-5-6-8-22(39)36-18-9-11-19(12-10-18)44-31(32,33)34/h9-12,14,35,40-41H,5-8,13H2,1-4H3,(H,36,39)/b23-16+ |
| InChIKey | UZTJOEZKBVYOBO-XQNSMLJCSA-N |
| XLogP | 5.26 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|