C25H27BrN2O3 — CID 163323150
2-ethylhexyl (E)-3-[5-bromo-2-(1-oxophthalazin-2-yl)phenyl]prop-2-enoate (PubChem CID 163323150) has the molecular formula C25H27BrN2O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-[5-bromo-2-(1-oxophthalazin-2-yl)phenyl]prop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-3-[5-bromo-2-(1-oxophthalazin-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 163323150 |
| Molecular Formula | C25H27BrN2O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-ethylhexyl (E)-3-[5-bromo-2-(1-oxophthalazin-2-yl)phenyl]prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/c1cc(Br)ccc1-n1ncc2ccccc2c1=O |
| InChI | InChI=1S/C25H27BrN2O3/c1-3-5-8-18(4-2)17-31-24(29)14-11-19-15-21(26)12-13-23(19)28-25(30)22-10-7-6-9-20(22)16-27-28/h6-7,9-16,18H,3-5,8,17H2,1-2H3/b14-11+ |
| InChIKey | JLJHMCCJUXULRG-SDNWHVSQSA-N |
| XLogP | 5.92 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|