C19H23N5O8S — CID 163331096
bis(N,N-dimethylformamide);methyl (2E)-2-[2-(4-nitrobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 163331096) has the molecular formula C19H23N5O8S and a molecular weight of 481.49 g/mol. Its IUPAC name is bis(N,N-dimethylformamide);methyl (2E)-2-[2-(4-nitrobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | bis(N,N-dimethylformamide);methyl (2E)-2-[2-(4-nitrobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 163331096 |
| Molecular Formula | C19H23N5O8S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | bis(N,N-dimethylformamide);methyl (2E)-2-[2-(4-nitrobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CN(C)C=O.CN(C)C=O.COC(=O)/C=C1/S/C(=N/C(=O)c2ccc([N+](=O)[O-])cc2)NC1=O |
| InChI | InChI=1S/C13H9N3O6S.2C3H7NO/c1-22-10(17)6-9-12(19)15-13(23-9)14-11(18)7-2-4-8(5-3-7)16(20)21;2*1-4(2)3-5/h2-6H,1H3,(H,14,15,18,19);2*3H,1-2H3/b9-6+;; |
| InChIKey | KUHSTSSMODWXJZ-SWSRPJROSA-N |
| XLogP | 0.42 |
| TPSA | 168.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|