C10H16ClN3 — CID 163386940
(Z,3E)-3-(1-chloroethylidene)-N-methyl-4-(methyldiazenyl)hex-4-en-2-imine (PubChem CID 163386940) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is (Z,3E)-3-(1-chloroethylidene)-N-methyl-4-(methyldiazenyl)hex-4-en-2-imine.
| Compound Name | (Z,3E)-3-(1-chloroethylidene)-N-methyl-4-(methyldiazenyl)hex-4-en-2-imine |
|---|---|
| PubChem CID | 163386940 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (Z,3E)-3-(1-chloroethylidene)-N-methyl-4-(methyldiazenyl)hex-4-en-2-imine |
| SMILES | C/C=C(\N=N\C)C(/C(C)=N/C)=C(/C)Cl |
| InChI | InChI=1S/C10H16ClN3/c1-6-9(14-13-5)10(7(2)11)8(3)12-4/h6H,1-5H3/b9-6-,10-7-,12-8+,14-13+ |
| InChIKey | QSMGNHFCADBSQV-AEHQAGQUSA-N |
| XLogP | 3.58 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|