C15H14N2O3S — CID 163387819
N-[2-(2-ethynyl-4-hydroxy-3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 163387819) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[2-(2-ethynyl-4-hydroxy-3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(2-ethynyl-4-hydroxy-3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 163387819 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-[2-(2-ethynyl-4-hydroxy-3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | C#Cc1c(CCNC(=O)c2cscn2)ccc(O)c1OC |
| InChI | InChI=1S/C15H14N2O3S/c1-3-11-10(4-5-13(18)14(11)20-2)6-7-16-15(19)12-8-21-9-17-12/h1,4-5,8-9,18H,6-7H2,2H3,(H,16,19) |
| InChIKey | LGESXSKGOACULA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|