C15H4F17O5S- — CID 163408219
4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-3-hydroxybenzenesulfonate (PubChem CID 163408219) has the molecular formula C15H4F17O5S- and a molecular weight of 619.23 g/mol. Its IUPAC name is 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-3-hydroxybenzenesulfonate.
| Compound Name | 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-3-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 163408219 |
| Molecular Formula | C15H4F17O5S- |
| Molecular Weight | 619.23 g/mol |
| Exact Mass | 618.95 |
| IUPAC Name | 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxy-3-hydroxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C15H5F17O5S/c16-9(12(21,22)23,13(24,25)26)7(10(17,14(27,28)29)15(30,31)32)8(11(18,19)20)37-6-2-1-4(3-5(6)33)38(34,35)36/h1-3,33H,(H,34,35,36)/p-1 |
| InChIKey | KNLGHLQRMPJMAL-UHFFFAOYSA-M |
| XLogP | 6.16 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.23 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|