C17H17Cl2N3 — CID 163408625
2-[(7-chloroquinolin-4-yl)amino]ethyl-bis(prop-2-ynyl)azanium chloride (PubChem CID 163408625) has the molecular formula C17H17Cl2N3 and a molecular weight of 334.25 g/mol. Its IUPAC name is 2-[(7-chloroquinolin-4-yl)amino]ethyl-bis(prop-2-ynyl)azanium chloride.
| Compound Name | 2-[(7-chloroquinolin-4-yl)amino]ethyl-bis(prop-2-ynyl)azanium chloride |
|---|---|
| PubChem CID | 163408625 |
| Molecular Formula | C17H17Cl2N3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[(7-chloroquinolin-4-yl)amino]ethyl-bis(prop-2-ynyl)azanium chloride |
| SMILES | C#CC[NH+](CC#C)CCNc1ccnc2cc(Cl)ccc12.[Cl-] |
| InChI | InChI=1S/C17H16ClN3.ClH/c1-3-10-21(11-4-2)12-9-20-16-7-8-19-17-13-14(18)5-6-15(16)17;/h1-2,5-8,13H,9-12H2,(H,19,20);1H |
| InChIKey | LZCALMSGYZPQDH-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 29.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|