C35H56N2O4S — CID 163431495
(4-methylphenyl)methyl N-[6-[2,5-dioxo-3-(2-pent-4-enylundecylsulfanyl)pyrrolidin-1-yl]hexyl]carbamate (PubChem CID 163431495) has the molecular formula C35H56N2O4S and a molecular weight of 600.91 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-[6-[2,5-dioxo-3-(2-pent-4-enylundecylsulfanyl)pyrrolidin-1-yl]hexyl]carbamate.
| Compound Name | (4-methylphenyl)methyl N-[6-[2,5-dioxo-3-(2-pent-4-enylundecylsulfanyl)pyrrolidin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 163431495 |
| Molecular Formula | C35H56N2O4S |
| Molecular Weight | 600.91 g/mol |
| Exact Mass | 600.40 |
| IUPAC Name | (4-methylphenyl)methyl N-[6-[2,5-dioxo-3-(2-pent-4-enylundecylsulfanyl)pyrrolidin-1-yl]hexyl]carbamate |
| SMILES | C=CCCCC(CCCCCCCCC)CSC1CC(=O)N(CCCCCCNC(=O)OCc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C35H56N2O4S/c1-4-6-8-9-10-11-15-19-31(18-14-7-5-2)28-42-32-26-33(38)37(34(32)39)25-17-13-12-16-24-36-35(40)41-27-30-22-20-29(3)21-23-30/h5,20-23,31-32H,2,4,6-19,24-28H2,1,3H3,(H,36,40) |
| InChIKey | AQVVTVJUTHQGMB-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.91 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|