C27H32ClF2N6S+ — CID 163462272
8-[1-(2-chloro-3,6-difluorophenyl)ethyl]-5,5-dimethyl-2-[3-(4-methylpiperazin-1-yl)phenyl]sulfanyl-6,7-dihydropyrazino[2,3-b]pyrazin-5-ium (PubChem CID 163462272) has the molecular formula C27H32ClF2N6S+ and a molecular weight of 546.11 g/mol. Its IUPAC name is 8-[1-(2-chloro-3,6-difluorophenyl)ethyl]-5,5-dimethyl-2-[3-(4-methylpiperazin-1-yl)phenyl]sulfanyl-6,7-dihydropyrazino[2,3-b]pyrazin-5-ium.
| Compound Name | 8-[1-(2-chloro-3,6-difluorophenyl)ethyl]-5,5-dimethyl-2-[3-(4-methylpiperazin-1-yl)phenyl]sulfanyl-6,7-dihydropyrazino[2,3-b]pyrazin-5-ium |
|---|---|
| PubChem CID | 163462272 |
| Molecular Formula | C27H32ClF2N6S+ |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 8-[1-(2-chloro-3,6-difluorophenyl)ethyl]-5,5-dimethyl-2-[3-(4-methylpiperazin-1-yl)phenyl]sulfanyl-6,7-dihydropyrazino[2,3-b]pyrazin-5-ium |
| SMILES | CC(c1c(F)ccc(F)c1Cl)N1CC[N+](C)(C)c2ncc(Sc3cccc(N4CCN(C)CC4)c3)nc21 |
| InChI | InChI=1S/C27H32ClF2N6S/c1-18(24-21(29)8-9-22(30)25(24)28)35-14-15-36(3,4)27-26(35)32-23(17-31-27)37-20-7-5-6-19(16-20)34-12-10-33(2)11-13-34/h5-9,16-18H,10-15H2,1-4H3/q+1 |
| InChIKey | RZPGKAMGPZMRFV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|