C15H22N2 — CID 163464894
(E)-2-N-(1-ethylcyclobut-2-en-1-yl)-3-[(Z)-prop-1-enyl]hex-3-ene-1,2-diimine (PubChem CID 163464894) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (E)-2-N-(1-ethylcyclobut-2-en-1-yl)-3-[(Z)-prop-1-enyl]hex-3-ene-1,2-diimine.
| Compound Name | (E)-2-N-(1-ethylcyclobut-2-en-1-yl)-3-[(Z)-prop-1-enyl]hex-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 163464894 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (E)-2-N-(1-ethylcyclobut-2-en-1-yl)-3-[(Z)-prop-1-enyl]hex-3-ene-1,2-diimine |
| SMILES | [H]/N=C/C(=N\C1(CC)C=CC1)C(/C=C\C)=C/CC |
| InChI | InChI=1S/C15H22N2/c1-4-8-13(9-5-2)14(12-16)17-15(6-3)10-7-11-15/h4,7-10,12,16H,5-6,11H2,1-3H3/b8-4-,13-9+,16-12+,17-14+ |
| InChIKey | BRRZMGGPMBNVKB-YSIPYVJBSA-N |
| XLogP | 4.10 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|