C32H45N5O6 — CID 163466120
tert-butyl N-[2-[2-[2-[8-[2-[(6-isocyanoindol-1-yl)methyl]imidazol-1-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 163466120) has the molecular formula C32H45N5O6 and a molecular weight of 595.74 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[8-[2-[(6-isocyanoindol-1-yl)methyl]imidazol-1-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[8-[2-[(6-isocyanoindol-1-yl)methyl]imidazol-1-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 163466120 |
| Molecular Formula | C32H45N5O6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[8-[2-[(6-isocyanoindol-1-yl)methyl]imidazol-1-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | [C-]#[N+]c1ccc2ccn(Cc3nccn3CCCCC(=O)CCCOCCOCCOCCNC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C32H45N5O6/c1-32(2,3)43-31(39)35-14-19-41-21-23-42-22-20-40-18-7-9-28(38)8-5-6-15-36-17-13-34-30(36)25-37-16-12-26-10-11-27(33-4)24-29(26)37/h10-13,16-17,24H,5-9,14-15,18-23,25H2,1-3H3,(H,35,39) |
| InChIKey | BSSSUBWPEYCVJY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|