C21H23ClN4O5 — CID 163479477
4-[3-chloro-4-[[ethylamino(hydroxy)methyl]amino]phenoxy]-N,7-dimethoxyquinoline-6-carboxamide (PubChem CID 163479477) has the molecular formula C21H23ClN4O5 and a molecular weight of 446.89 g/mol. Its IUPAC name is 4-[3-chloro-4-[[ethylamino(hydroxy)methyl]amino]phenoxy]-N,7-dimethoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[[ethylamino(hydroxy)methyl]amino]phenoxy]-N,7-dimethoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 163479477 |
| Molecular Formula | C21H23ClN4O5 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[3-chloro-4-[[ethylamino(hydroxy)methyl]amino]phenoxy]-N,7-dimethoxyquinoline-6-carboxamide |
| SMILES | CCNC(O)Nc1ccc(Oc2ccnc3cc(OC)c(C(=O)NOC)cc23)cc1Cl |
| InChI | InChI=1S/C21H23ClN4O5/c1-4-23-21(28)25-16-6-5-12(9-15(16)22)31-18-7-8-24-17-11-19(29-2)14(10-13(17)18)20(27)26-30-3/h5-11,21,23,25,28H,4H2,1-3H3,(H,26,27) |
| InChIKey | CDGZTLDZCGWRSO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|