C16H20N4O3S2 — CID 163481710
N-[(2R)-2-[[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]amino]pent-3-ynyl]thiophene-2-sulfonamide (PubChem CID 163481710) has the molecular formula C16H20N4O3S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-[(2R)-2-[[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]amino]pent-3-ynyl]thiophene-2-sulfonamide.
| Compound Name | N-[(2R)-2-[[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]amino]pent-3-ynyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 163481710 |
| Molecular Formula | C16H20N4O3S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[(2R)-2-[[5-(2-hydroxypropan-2-yl)pyrimidin-2-yl]amino]pent-3-ynyl]thiophene-2-sulfonamide |
| SMILES | CC#C[C@H](CNS(=O)(=O)c1cccs1)Nc1ncc(C(C)(C)O)cn1 |
| InChI | InChI=1S/C16H20N4O3S2/c1-4-6-13(11-19-25(22,23)14-7-5-8-24-14)20-15-17-9-12(10-18-15)16(2,3)21/h5,7-10,13,19,21H,11H2,1-3H3,(H,17,18,20)/t13-/m1/s1 |
| InChIKey | CFCWSUBPDWPEJL-CYBMUJFWSA-N |
| XLogP | 1.55 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|