C25H17F7N2O3 — CID 163487252
amino 3-fluoro-5-[2-[5-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methoxy]-3-pyridinyl]cyclopenten-1-yl]benzoate (PubChem CID 163487252) has the molecular formula C25H17F7N2O3 and a molecular weight of 526.41 g/mol. Its IUPAC name is amino 3-fluoro-5-[2-[5-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methoxy]-3-pyridinyl]cyclopenten-1-yl]benzoate.
| Compound Name | amino 3-fluoro-5-[2-[5-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methoxy]-3-pyridinyl]cyclopenten-1-yl]benzoate |
|---|---|
| PubChem CID | 163487252 |
| Molecular Formula | C25H17F7N2O3 |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | amino 3-fluoro-5-[2-[5-(trifluoromethyl)-2-[(2,4,6-trifluorophenyl)methoxy]-3-pyridinyl]cyclopenten-1-yl]benzoate |
| SMILES | NOC(=O)c1cc(F)cc(C2=C(c3cc(C(F)(F)F)cnc3OCc3c(F)cc(F)cc3F)CCC2)c1 |
| InChI | InChI=1S/C25H17F7N2O3/c26-15-5-12(4-13(6-15)24(35)37-33)17-2-1-3-18(17)19-7-14(25(30,31)32)10-34-23(19)36-11-20-21(28)8-16(27)9-22(20)29/h4-10H,1-3,11,33H2 |
| InChIKey | XOTHTHNDXCWNOC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|