C23H27ClN2O — CID 163493220
2-[(E)-2-(5-chloro-3-ethyl-3-methylindol-2-yl)ethenyl]-5-(diethylamino)phenol (PubChem CID 163493220) has the molecular formula C23H27ClN2O and a molecular weight of 382.94 g/mol. Its IUPAC name is 2-[(E)-2-(5-chloro-3-ethyl-3-methylindol-2-yl)ethenyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(E)-2-(5-chloro-3-ethyl-3-methylindol-2-yl)ethenyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 163493220 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-[(E)-2-(5-chloro-3-ethyl-3-methylindol-2-yl)ethenyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/C=C/C2=Nc3ccc(Cl)cc3C2(C)CC)c(O)c1 |
| InChI | InChI=1S/C23H27ClN2O/c1-5-23(4)19-14-17(24)10-12-20(19)25-22(23)13-9-16-8-11-18(15-21(16)27)26(6-2)7-3/h8-15,27H,5-7H2,1-4H3/b13-9+ |
| InChIKey | COJYXRVNIAZTCC-UKTHLTGXSA-N |
| XLogP | 6.36 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|