C18H21FN2O4S — CID 163520060
3-[5-(3-fluoro-4-prop-1-ynylphenyl)-3,4-dihydro-2H-pyrrol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 163520060) has the molecular formula C18H21FN2O4S and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-[5-(3-fluoro-4-prop-1-ynylphenyl)-3,4-dihydro-2H-pyrrol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[5-(3-fluoro-4-prop-1-ynylphenyl)-3,4-dihydro-2H-pyrrol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 163520060 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-[5-(3-fluoro-4-prop-1-ynylphenyl)-3,4-dihydro-2H-pyrrol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC#Cc1ccc(C2=NCC(CC(C)(C(=O)NO)S(C)(=O)=O)C2)cc1F |
| InChI | InChI=1S/C18H21FN2O4S/c1-4-5-13-6-7-14(9-15(13)19)16-8-12(11-20-16)10-18(2,17(22)21-23)26(3,24)25/h6-7,9,12,23H,8,10-11H2,1-3H3,(H,21,22) |
| InChIKey | DKANPNDJTVNMPF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|