C14H23N3O3Si — CID 163520574
(2,6-dimethyl-3H-benzotriazol-1-yl) 2-trimethylsilylethyl carbonate (PubChem CID 163520574) has the molecular formula C14H23N3O3Si and a molecular weight of 309.44 g/mol. Its IUPAC name is (2,6-dimethyl-3H-benzotriazol-1-yl) 2-trimethylsilylethyl carbonate.
| Compound Name | (2,6-dimethyl-3H-benzotriazol-1-yl) 2-trimethylsilylethyl carbonate |
|---|---|
| PubChem CID | 163520574 |
| Molecular Formula | C14H23N3O3Si |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2,6-dimethyl-3H-benzotriazol-1-yl) 2-trimethylsilylethyl carbonate |
| SMILES | Cc1ccc2c(c1)N(OC(=O)OCC[Si](C)(C)C)N(C)N2 |
| InChI | InChI=1S/C14H23N3O3Si/c1-11-6-7-12-13(10-11)17(16(2)15-12)20-14(18)19-8-9-21(3,4)5/h6-7,10,15H,8-9H2,1-5H3 |
| InChIKey | DKLKYKYLCSZMNJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|