About 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine
6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine (PubChem CID 163524834) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine.
Analyze 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine (CID 163524834) is 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine is CC1=CN2C=C(Br)C=CC2N1.
What is the InChIKey of 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine?
The InChIKey is DNWBVRRDEOPBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2/c1-6-4-11-5-7(9)2-3-8(11)10-6/h2-5,8,10H,1H3.
What are the key properties of 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine?
6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine has a molecular weight of 213.08 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 163524834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).