C26H38O6 — CID 163534361
(4-methoxyphenyl)methyl 6-hydroxynon-8-enoate;7-prop-2-enyloxepan-2-one (PubChem CID 163534361) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 6-hydroxynon-8-enoate;7-prop-2-enyloxepan-2-one.
| Compound Name | (4-methoxyphenyl)methyl 6-hydroxynon-8-enoate;7-prop-2-enyloxepan-2-one |
|---|---|
| PubChem CID | 163534361 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (4-methoxyphenyl)methyl 6-hydroxynon-8-enoate;7-prop-2-enyloxepan-2-one |
| SMILES | C=CCC(O)CCCCC(=O)OCc1ccc(OC)cc1.C=CCC1CCCCC(=O)O1 |
| InChI | InChI=1S/C17H24O4.C9H14O2/c1-3-6-15(18)7-4-5-8-17(19)21-13-14-9-11-16(20-2)12-10-14;1-2-5-8-6-3-4-7-9(10)11-8/h3,9-12,15,18H,1,4-8,13H2,2H3;2,8H,1,3-7H2 |
| InChIKey | DVRNORAYJLSTIT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|