C4H8NO2- — CID 163537436
4-methyl-2-oxido-1,2-oxazolidine (PubChem CID 163537436) has the molecular formula C4H8NO2- and a molecular weight of 102.11 g/mol. Its IUPAC name is 4-methyl-2-oxido-1,2-oxazolidine.
| Compound Name | 4-methyl-2-oxido-1,2-oxazolidine |
|---|---|
| PubChem CID | 163537436 |
| Molecular Formula | C4H8NO2- |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | 4-methyl-2-oxido-1,2-oxazolidine |
| SMILES | CC1CON([O-])C1 |
| InChI | InChI=1S/C4H8NO2/c1-4-2-5(6)7-3-4/h4H,2-3H2,1H3/q-1 |
| InChIKey | UTNUKRYSHMXQSW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |