C14H23N2O7PS2 — CID 163553310
2-(2-hydroxyethyldisulfanyl)ethyl [(2S,5R)-5-(4-methylidene-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 163553310) has the molecular formula C14H23N2O7PS2 and a molecular weight of 426.45 g/mol. Its IUPAC name is 2-(2-hydroxyethyldisulfanyl)ethyl [(2S,5R)-5-(4-methylidene-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | 2-(2-hydroxyethyldisulfanyl)ethyl [(2S,5R)-5-(4-methylidene-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 163553310 |
| Molecular Formula | C14H23N2O7PS2 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-(2-hydroxyethyldisulfanyl)ethyl [(2S,5R)-5-(4-methylidene-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | C=C1C=CN([C@H]2CC[C@@H](COP(=O)(O)OCCSSCCO)O2)C(=O)N1 |
| InChI | InChI=1S/C14H23N2O7PS2/c1-11-4-5-16(14(18)15-11)13-3-2-12(23-13)10-22-24(19,20)21-7-9-26-25-8-6-17/h4-5,12-13,17H,1-3,6-10H2,(H,15,18)(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | FKXNVXFEXWXDPQ-QWHCGFSZSA-N |
| XLogP | 2.05 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|