C17H29N2O8PS — CID 153342483
methanol;[5-(5-methyl-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl [(3Z)-penta-1,3-dien-2-yl] hydrogen phosphate (PubChem CID 153342483) has the molecular formula C17H29N2O8PS and a molecular weight of 452.47 g/mol. Its IUPAC name is methanol;[5-(5-methyl-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl [(3Z)-penta-1,3-dien-2-yl] hydrogen phosphate.
| Compound Name | methanol;[5-(5-methyl-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl [(3Z)-penta-1,3-dien-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 153342483 |
| Molecular Formula | C17H29N2O8PS |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methanol;[5-(5-methyl-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl [(3Z)-penta-1,3-dien-2-yl] hydrogen phosphate |
| SMILES | C=C(/C=C\C)OP(=O)(O)OCC1CCC(n2cc(C)c(=S)[nH]c2=O)O1.CO.CO |
| InChI | InChI=1S/C15H21N2O6PS.2CH4O/c1-4-5-11(3)23-24(19,20)21-9-12-6-7-13(22-12)17-8-10(2)14(25)16-15(17)18;2*1-2/h4-5,8,12-13H,3,6-7,9H2,1-2H3,(H,19,20)(H,16,18,25);2*2H,1H3/b5-4-;; |
| InChIKey | UGTJAFKDVAYZLA-WNCVTPEDSA-N |
| XLogP | 2.33 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|