C8H16O2 — CID 163579473
(2R,3R,5S)-3-ethoxy-2,5-dimethyloxolane (PubChem CID 163579473) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (2R,3R,5S)-3-ethoxy-2,5-dimethyloxolane.
| Compound Name | (2R,3R,5S)-3-ethoxy-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 163579473 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (2R,3R,5S)-3-ethoxy-2,5-dimethyloxolane |
| SMILES | CCO[C@@H]1C[C@H](C)O[C@@H]1C |
| InChI | InChI=1S/C8H16O2/c1-4-9-8-5-6(2)10-7(8)3/h6-8H,4-5H2,1-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | AGTVXMSPABMELH-XLPZGREQSA-N |
| XLogP | 1.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |