C26H16F5N — CID 163585581
3-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluorophenyl]-6-ethenyl-2-fluoropyridine (PubChem CID 163585581) has the molecular formula C26H16F5N and a molecular weight of 437.41 g/mol. Its IUPAC name is 3-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluorophenyl]-6-ethenyl-2-fluoropyridine.
| Compound Name | 3-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluorophenyl]-6-ethenyl-2-fluoropyridine |
|---|---|
| PubChem CID | 163585581 |
| Molecular Formula | C26H16F5N |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-[4-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluorophenyl]-6-ethenyl-2-fluoropyridine |
| SMILES | C=Cc1ccc(-c2ccc(-c3ccc(-c4ccc(C)c(F)c4F)cc3)c(F)c2F)c(F)n1 |
| InChI | InChI=1S/C26H16F5N/c1-3-17-9-11-21(26(31)32-17)20-13-12-19(24(29)25(20)30)16-7-5-15(6-8-16)18-10-4-14(2)22(27)23(18)28/h3-13H,1H2,2H3 |
| InChIKey | GLEWPLPCYYEUDP-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|