C21H24IO3- — CID 163587098
CID 163587098 (PubChem CID 163587098) has the molecular formula C21H24IO3- and a molecular weight of 451.32 g/mol.
| Compound Name | CID 163587098 |
|---|---|
| PubChem CID | 163587098 |
| Molecular Formula | C21H24IO3- |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | — |
| SMILES | C=CC(=O)OCC[I-](C)(C)Cc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24IO3/c1-4-20(23)25-15-14-22(2,3)16-17-10-12-19(13-11-17)21(24)18-8-6-5-7-9-18/h4-13H,1,14-16H2,2-3H3/q-1 |
| InChIKey | WYERFVNNTPDXCE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|