C7H14IN — CID 163591567
cis-(2R,3R)-3-ethyl-2-iodocyclopentan-1-amine (PubChem CID 163591567) has the molecular formula C7H14IN and a molecular weight of 239.10 g/mol. Its IUPAC name is cis-(2R,3R)-3-ethyl-2-iodocyclopentan-1-amine.
| Compound Name | cis-(2R,3R)-3-ethyl-2-iodocyclopentan-1-amine |
|---|---|
| PubChem CID | 163591567 |
| Molecular Formula | C7H14IN |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | cis-(2R,3R)-3-ethyl-2-iodocyclopentan-1-amine |
| SMILES | CC[C@@H]1CCC(N)[C@@H]1I |
| InChI | InChI=1S/C7H14IN/c1-2-5-3-4-6(9)7(5)8/h5-7H,2-4,9H2,1H3/t5-,6?,7-/m1/s1 |
| InChIKey | GPYFBMRIPPPZEF-YFBHCESUSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|