C9H15NO — CID 163604604
(2Z,4Z)-5-methyl-1-nitrosoocta-2,4-diene (PubChem CID 163604604) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2Z,4Z)-5-methyl-1-nitrosoocta-2,4-diene.
| Compound Name | (2Z,4Z)-5-methyl-1-nitrosoocta-2,4-diene |
|---|---|
| PubChem CID | 163604604 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2Z,4Z)-5-methyl-1-nitrosoocta-2,4-diene |
| SMILES | CCC/C(C)=C\C=C/CN=O |
| InChI | InChI=1S/C9H15NO/c1-3-6-9(2)7-4-5-8-10-11/h4-5,7H,3,6,8H2,1-2H3/b5-4-,9-7- |
| InChIKey | HAQVFVJAPCEMNS-PHSHQRSZSA-N |
| XLogP | 3.06 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|