C13H9IN6O5S — CID 163614539
N-(1λ3-ioda-5-thia-2,3-diazacyclopenta-1,3-dien-4-yl)-6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-8-carboxamide (PubChem CID 163614539) has the molecular formula C13H9IN6O5S and a molecular weight of 488.22 g/mol. Its IUPAC name is N-(1λ3-ioda-5-thia-2,3-diazacyclopenta-1,3-dien-4-yl)-6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-8-carboxamide.
| Compound Name | N-(1λ3-ioda-5-thia-2,3-diazacyclopenta-1,3-dien-4-yl)-6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-8-carboxamide |
|---|---|
| PubChem CID | 163614539 |
| Molecular Formula | C13H9IN6O5S |
| Molecular Weight | 488.22 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | N-(1λ3-ioda-5-thia-2,3-diazacyclopenta-1,3-dien-4-yl)-6-nitro-2,3-dioxo-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-8-carboxamide |
| SMILES | O=C(NC1=NN=IS1)C1Cc2c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C13H9IN6O5S/c21-10(17-13-18-19-14-26-13)4-1-5-6(2-4)9-7(3-8(5)20(24)25)15-11(22)12(23)16-9/h3-4H,1-2H2,(H,15,22)(H,16,23)(H,17,18,21) |
| InChIKey | HIVVNVFBSPIPIL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|