C25H26O8 — CID 163620799
[(3S)-2,3-diacetyloxy-4-(2-phenylmethoxyethyl)-2,3-dihydrofuran-5-yl]methyl benzoate (PubChem CID 163620799) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is [(3S)-2,3-diacetyloxy-4-(2-phenylmethoxyethyl)-2,3-dihydrofuran-5-yl]methyl benzoate.
| Compound Name | [(3S)-2,3-diacetyloxy-4-(2-phenylmethoxyethyl)-2,3-dihydrofuran-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 163620799 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [(3S)-2,3-diacetyloxy-4-(2-phenylmethoxyethyl)-2,3-dihydrofuran-5-yl]methyl benzoate |
| SMILES | CC(=O)OC1OC(COC(=O)c2ccccc2)=C(CCOCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H26O8/c1-17(26)31-23-21(13-14-29-15-19-9-5-3-6-10-19)22(33-25(23)32-18(2)27)16-30-24(28)20-11-7-4-8-12-20/h3-12,23,25H,13-16H2,1-2H3/t23-,25?/m0/s1 |
| InChIKey | HNXYPOJEBVQZEC-LFQPHHBNSA-N |
| XLogP | 3.56 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|