About N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide
N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide (PubChem CID 163631009) has the molecular formula C18H17IN2O2
and a molecular weight of 420.25 g/mol. Its IUPAC name is N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide.
Molecular Properties
| Compound Name | N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide |
| PubChem CID | 163631009 |
| Molecular Formula | C18H17IN2O2 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide |
| SMILES | [I-].[O-][NH+](c1ccccc1)[NH+](Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17N2O2.HI/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22-18-14-8-3-9-15-18;/h1-15,19-20H;1H/q+1;/p-1 |
| InChIKey | JDDFFAFULBNNHT-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 41.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide?
The IUPAC name of N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide (CID 163631009) is N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide.
What is the SMILES notation for N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide?
The canonical SMILES for N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide is [I-].[O-][NH+](c1ccccc1)[NH+](Oc1ccccc1)c1ccccc1.
What is the InChIKey of N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide?
The InChIKey is JDDFFAFULBNNHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H17N2O2.HI/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22-18-14-8-3-9-15-18;/h1-15,19-20H;1H/q+1;/p-1.
What are the key properties of N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide?
N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide has a molecular weight of 420.25 g/mol, XLogP of -1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[phenoxy(phenyl)azaniumyl]benzeneamine oxide iodide is sourced from PubChem (CID 163631009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).