About diphenoxytin(2+) dichloride
diphenoxytin(2+) dichloride (PubChem CID 66896970) has the molecular formula C12H10Cl2O2Sn
and a molecular weight of 375.83 g/mol. Its IUPAC name is diphenoxytin(2+) dichloride.
Molecular Properties
| Compound Name | diphenoxytin(2+) dichloride |
| PubChem CID | 66896970 |
| Molecular Formula | C12H10Cl2O2Sn |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.91 |
| IUPAC Name | diphenoxytin(2+) dichloride |
| SMILES | [Cl-].[Cl-].c1ccc(O[Sn+2]Oc2ccccc2)cc1 |
| InChI | InChI=1S/2C6H6O.2ClH.Sn/c2*7-6-4-2-1-3-5-6;;;/h2*1-5,7H;2*1H;/q;;;;+4/p-4 |
| InChIKey | NPOLKQYEZJYGFC-UHFFFAOYSA-J |
| XLogP | -3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenoxytin(2+) dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenoxytin(2+) dichloride?
The IUPAC name of diphenoxytin(2+) dichloride (CID 66896970) is diphenoxytin(2+) dichloride.
What is the SMILES notation for diphenoxytin(2+) dichloride?
The canonical SMILES for diphenoxytin(2+) dichloride is [Cl-].[Cl-].c1ccc(O[Sn+2]Oc2ccccc2)cc1.
What is the InChIKey of diphenoxytin(2+) dichloride?
The InChIKey is NPOLKQYEZJYGFC-UHFFFAOYSA-J. The full InChI is InChI=1S/2C6H6O.2ClH.Sn/c2*7-6-4-2-1-3-5-6;;;/h2*1-5,7H;2*1H;/q;;;;+4/p-4.
What are the key properties of diphenoxytin(2+) dichloride?
diphenoxytin(2+) dichloride has a molecular weight of 375.83 g/mol, XLogP of -3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenoxytin(2+) dichloride is sourced from PubChem (CID 66896970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).